C19H18F2N2O2 — CID 154975398
2-[[3-(1,1-difluoroethyl)phenyl]methylamino]-6-methoxy-1H-quinolin-4-one (PubChem CID 154975398) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[[3-(1,1-difluoroethyl)phenyl]methylamino]-6-methoxy-1H-quinolin-4-one.
| Compound Name | 2-[[3-(1,1-difluoroethyl)phenyl]methylamino]-6-methoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 154975398 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[3-(1,1-difluoroethyl)phenyl]methylamino]-6-methoxy-1H-quinolin-4-one |
| SMILES | COc1ccc2[nH]c(NCc3cccc(C(C)(F)F)c3)cc(=O)c2c1 |
| InChI | InChI=1S/C19H18F2N2O2/c1-19(20,21)13-5-3-4-12(8-13)11-22-18-10-17(24)15-9-14(25-2)6-7-16(15)23-18/h3-10H,11H2,1-2H3,(H2,22,23,24) |
| InChIKey | LRIOEJFSETYBJW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |