C11H18F3NO2 — CID 154985816
(2E,4Z)-7,7,7-trifluoro-1-(2-methoxyethoxy)-6-methylhepta-2,4-dien-3-amine (PubChem CID 154985816) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is (2E,4Z)-7,7,7-trifluoro-1-(2-methoxyethoxy)-6-methylhepta-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-7,7,7-trifluoro-1-(2-methoxyethoxy)-6-methylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 154985816 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2E,4Z)-7,7,7-trifluoro-1-(2-methoxyethoxy)-6-methylhepta-2,4-dien-3-amine |
| SMILES | COCCOC/C=C(N)\C=C/C(C)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2/c1-9(11(12,13)14)3-4-10(15)5-6-17-8-7-16-2/h3-5,9H,6-8,15H2,1-2H3/b4-3-,10-5+ |
| InChIKey | XGOLAYPQPDQGON-DXWLQBKVSA-N |
| XLogP | 2.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|