C13H20F3NO2 — CID 143086038
ethane;2-(2-methoxyethoxy)-6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-amine (PubChem CID 143086038) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethane;2-(2-methoxyethoxy)-6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-amine.
| Compound Name | ethane;2-(2-methoxyethoxy)-6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 143086038 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | ethane;2-(2-methoxyethoxy)-6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-amine |
| SMILES | CC.COCCOC1=C(N)C=C(C(F)(F)F)CC=C1 |
| InChI | InChI=1S/C11H14F3NO2.C2H6/c1-16-5-6-17-10-4-2-3-8(7-9(10)15)11(12,13)14;1-2/h2,4,7H,3,5-6,15H2,1H3;1-2H3 |
| InChIKey | MGINDZJHYNKHGJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|