C13H24FNO — CID 163241945
ethane;(3E,5Z)-4-(1-fluoroethoxy)nona-1,3,5-trien-2-amine (PubChem CID 163241945) has the molecular formula C13H24FNO and a molecular weight of 229.34 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-(1-fluoroethoxy)nona-1,3,5-trien-2-amine.
| Compound Name | ethane;(3E,5Z)-4-(1-fluoroethoxy)nona-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 163241945 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | ethane;(3E,5Z)-4-(1-fluoroethoxy)nona-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(\C=C/CCC)OC(C)F.CC |
| InChI | InChI=1S/C11H18FNO.C2H6/c1-4-5-6-7-11(8-9(2)13)14-10(3)12;1-2/h6-8,10H,2,4-5,13H2,1,3H3;1-2H3/b7-6-,11-8+; |
| InChIKey | SKCBRFQBXYANRQ-DWROGWBBSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|