C10H17N — CID 126687303
(3E,5Z)-4-methylnona-1,3,5-trien-3-amine (PubChem CID 126687303) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3E,5Z)-4-methylnona-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-4-methylnona-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 126687303 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3E,5Z)-4-methylnona-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(C)\C=C/CCC |
| InChI | InChI=1S/C10H17N/c1-4-6-7-8-9(3)10(11)5-2/h5,7-8H,2,4,6,11H2,1,3H3/b8-7-,10-9+ |
| InChIKey | RTTXHTWHHXMHCZ-UQGDGPGGSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|