C11H17F2NO — CID 156872451
(4E)-4-(2,2-difluoroethoxy)-2,6-dimethylhepta-2,4,6-trien-3-amine (PubChem CID 156872451) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is (4E)-4-(2,2-difluoroethoxy)-2,6-dimethylhepta-2,4,6-trien-3-amine.
| Compound Name | (4E)-4-(2,2-difluoroethoxy)-2,6-dimethylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 156872451 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (4E)-4-(2,2-difluoroethoxy)-2,6-dimethylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C=C(/OCC(F)F)C(N)=C(C)C |
| InChI | InChI=1S/C11H17F2NO/c1-7(2)5-9(11(14)8(3)4)15-6-10(12)13/h5,10H,1,6,14H2,2-4H3/b9-5+ |
| InChIKey | NUVPGBZJYWJSDB-WEVVVXLNSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|