C12H23NO — CID 143256813
ethane;(2E,4E,6Z)-3-methoxy-6-methylocta-2,4,6-trien-4-amine (PubChem CID 143256813) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;(2E,4E,6Z)-3-methoxy-6-methylocta-2,4,6-trien-4-amine.
| Compound Name | ethane;(2E,4E,6Z)-3-methoxy-6-methylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 143256813 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;(2E,4E,6Z)-3-methoxy-6-methylocta-2,4,6-trien-4-amine |
| SMILES | C/C=C(C)\C=C(N)/C(=C\C)OC.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-5-8(3)7-9(11)10(6-2)12-4;1-2/h5-7H,11H2,1-4H3;1-2H3/b8-5-,9-7+,10-6+; |
| InChIKey | LMJHRYRPINRGOC-HBJHITRFSA-N |
| XLogP | 3.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|