C17H12 — CID 15498615
1-(2-cyclopenta-2,4-dien-1-ylethynyl)naphthalene (PubChem CID 15498615) has the molecular formula C17H12 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2-cyclopenta-2,4-dien-1-ylethynyl)naphthalene.
| Compound Name | 1-(2-cyclopenta-2,4-dien-1-ylethynyl)naphthalene |
|---|---|
| PubChem CID | 15498615 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2-cyclopenta-2,4-dien-1-ylethynyl)naphthalene |
| SMILES | C(#CC1C=CC=C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12/c1-2-7-14(6-1)12-13-16-10-5-9-15-8-3-4-11-17(15)16/h1-11,14H |
| InChIKey | YSXFZJODGLOJCO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|