C18H16F6NO4+ — CID 154990244
3-cyclopropyl-1-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-(trifluoromethyl)pyridin-1-ium (PubChem CID 154990244) has the molecular formula C18H16F6NO4+ and a molecular weight of 424.32 g/mol. Its IUPAC name is 3-cyclopropyl-1-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-(trifluoromethyl)pyridin-1-ium.
| Compound Name | 3-cyclopropyl-1-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-(trifluoromethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 154990244 |
| Molecular Formula | C18H16F6NO4+ |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-cyclopropyl-1-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-(trifluoromethyl)pyridin-1-ium |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1cc(C2CC2)c(C(F)(F)F)[n+](OC)c1 |
| InChI | InChI=1S/C18H16F6NO4/c1-26-15-8-11(29-18(22,23)24)5-6-14(15)28-12-7-13(10-3-4-10)16(17(19,20)21)25(9-12)27-2/h5-10H,3-4H2,1-2H3/q+1 |
| InChIKey | WFIWIRPGDDQDRM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|