C10H19F2O3P — CID 15499030
(Z)-1-diethoxyphosphoryl-1,3-difluorohex-2-ene (PubChem CID 15499030) has the molecular formula C10H19F2O3P and a molecular weight of 256.23 g/mol. Its IUPAC name is (Z)-1-diethoxyphosphoryl-1,3-difluorohex-2-ene.
| Compound Name | (Z)-1-diethoxyphosphoryl-1,3-difluorohex-2-ene |
|---|---|
| PubChem CID | 15499030 |
| Molecular Formula | C10H19F2O3P |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (Z)-1-diethoxyphosphoryl-1,3-difluorohex-2-ene |
| SMILES | CCC/C(F)=C/C(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H19F2O3P/c1-4-7-9(11)8-10(12)16(13,14-5-2)15-6-3/h8,10H,4-7H2,1-3H3/b9-8- |
| InChIKey | NADHOEOKKDRCNP-HJWRWDBZSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|