C22H39N2OP — CID 154992837
[4-[2-[3-methyl-3-(4-propan-2-yl-1,4-diazepan-1-yl)butoxy]propan-2-yl]phenyl]phosphane (PubChem CID 154992837) has the molecular formula C22H39N2OP and a molecular weight of 378.54 g/mol. Its IUPAC name is [4-[2-[3-methyl-3-(4-propan-2-yl-1,4-diazepan-1-yl)butoxy]propan-2-yl]phenyl]phosphane.
| Compound Name | [4-[2-[3-methyl-3-(4-propan-2-yl-1,4-diazepan-1-yl)butoxy]propan-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 154992837 |
| Molecular Formula | C22H39N2OP |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | [4-[2-[3-methyl-3-(4-propan-2-yl-1,4-diazepan-1-yl)butoxy]propan-2-yl]phenyl]phosphane |
| SMILES | CC(C)N1CCCN(C(C)(C)CCOC(C)(C)c2ccc(P)cc2)CC1 |
| InChI | InChI=1S/C22H39N2OP/c1-18(2)23-13-7-14-24(16-15-23)21(3,4)12-17-25-22(5,6)19-8-10-20(26)11-9-19/h8-11,18H,7,12-17,26H2,1-6H3 |
| InChIKey | INIVCHQTUPSILM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|