C20H25N5O — CID 154994240
[7-[3-methyl-4-(methyldiazenyl)phenyl]-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 154994240) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is [7-[3-methyl-4-(methyldiazenyl)phenyl]-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [7-[3-methyl-4-(methyldiazenyl)phenyl]-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 154994240 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | [7-[3-methyl-4-(methyldiazenyl)phenyl]-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C/N=N/c1ccc(N2CCCc3cc(C(=O)N4CCCC4)[nH]c32)cc1C |
| InChI | InChI=1S/C20H25N5O/c1-14-12-16(7-8-17(14)23-21-2)25-11-5-6-15-13-18(22-19(15)25)20(26)24-9-3-4-10-24/h7-8,12-13,22H,3-6,9-11H2,1-2H3/b23-21+ |
| InChIKey | KIUVZVLLODFYIN-XTQSDGFTSA-N |
| XLogP | 4.36 |
| TPSA | 64.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|