C22H23N3O2 — CID 166886523
4-[2-(3-methylideneazetidine-1-carbonyl)-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-7-yl]-2-prop-2-enylbenzaldehyde (PubChem CID 166886523) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[2-(3-methylideneazetidine-1-carbonyl)-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-7-yl]-2-prop-2-enylbenzaldehyde.
| Compound Name | 4-[2-(3-methylideneazetidine-1-carbonyl)-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-7-yl]-2-prop-2-enylbenzaldehyde |
|---|---|
| PubChem CID | 166886523 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-[2-(3-methylideneazetidine-1-carbonyl)-1,4,5,6-tetrahydropyrrolo[2,3-b]pyridin-7-yl]-2-prop-2-enylbenzaldehyde |
| SMILES | C=CCc1cc(N2CCCc3cc(C(=O)N4CC(=C)C4)[nH]c32)ccc1C=O |
| InChI | InChI=1S/C22H23N3O2/c1-3-5-16-10-19(8-7-18(16)14-26)25-9-4-6-17-11-20(23-21(17)25)22(27)24-12-15(2)13-24/h3,7-8,10-11,14,23H,1-2,4-6,9,12-13H2 |
| InChIKey | GAXXSULNNDJUNZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|