C18H22N2O5S2 — CID 154997106
3-[4-(oxan-4-ylsulfonyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 154997106) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[4-(oxan-4-ylsulfonyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[4-(oxan-4-ylsulfonyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 154997106 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[4-(oxan-4-ylsulfonyl)morpholin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)c1sc2ccccc2c1C1CN(S(=O)(=O)C2CCOCC2)CCO1 |
| InChI | InChI=1S/C18H22N2O5S2/c19-18(21)17-16(13-3-1-2-4-15(13)26-17)14-11-20(7-10-25-14)27(22,23)12-5-8-24-9-6-12/h1-4,12,14H,5-11H2,(H2,19,21) |
| InChIKey | QVZZFPJNSGYBIZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |