C21H20N2O6S2 — CID 164708224
methyl 4-[(2R)-2-(2-carbamoyl-1-benzothiophen-3-yl)morpholin-4-yl]sulfonylbenzoate (PubChem CID 164708224) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl 4-[(2R)-2-(2-carbamoyl-1-benzothiophen-3-yl)morpholin-4-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[(2R)-2-(2-carbamoyl-1-benzothiophen-3-yl)morpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 164708224 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | methyl 4-[(2R)-2-(2-carbamoyl-1-benzothiophen-3-yl)morpholin-4-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCO[C@H](c3c(C(N)=O)sc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C21H20N2O6S2/c1-28-21(25)13-6-8-14(9-7-13)31(26,27)23-10-11-29-16(12-23)18-15-4-2-3-5-17(15)30-19(18)20(22)24/h2-9,16H,10-12H2,1H3,(H2,22,24)/t16-/m0/s1 |
| InChIKey | WWKBKKLRPQWNRU-INIZCTEOSA-N |
| XLogP | 2.55 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |