C18H21NO5S2 — CID 164708196
3-(4-cyclopentylsulfonylmorpholin-2-yl)-1-benzothiophene-2-carboxylic acid (PubChem CID 164708196) has the molecular formula C18H21NO5S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(4-cyclopentylsulfonylmorpholin-2-yl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(4-cyclopentylsulfonylmorpholin-2-yl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 164708196 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-(4-cyclopentylsulfonylmorpholin-2-yl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2ccccc2c1C1CN(S(=O)(=O)C2CCCC2)CCO1 |
| InChI | InChI=1S/C18H21NO5S2/c20-18(21)17-16(13-7-3-4-8-15(13)25-17)14-11-19(9-10-24-14)26(22,23)12-5-1-2-6-12/h3-4,7-8,12,14H,1-2,5-6,9-11H2,(H,20,21) |
| InChIKey | XRIUWNCZVUPKAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |