C17H20O4 — CID 154997620
5,5-bis(prop-2-ynoxymethyl)nona-1,8-diyne-4,6-diol (PubChem CID 154997620) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 5,5-bis(prop-2-ynoxymethyl)nona-1,8-diyne-4,6-diol.
| Compound Name | 5,5-bis(prop-2-ynoxymethyl)nona-1,8-diyne-4,6-diol |
|---|---|
| PubChem CID | 154997620 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5,5-bis(prop-2-ynoxymethyl)nona-1,8-diyne-4,6-diol |
| SMILES | C#CCOCC(COCC#C)(C(O)CC#C)C(O)CC#C |
| InChI | InChI=1S/C17H20O4/c1-5-9-15(18)17(13-20-11-7-3,14-21-12-8-4)16(19)10-6-2/h1-4,15-16,18-19H,9-14H2 |
| InChIKey | HHMVROOIONRQNK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|