C19H28F4O9 — CID 160721729
1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-ynoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol (PubChem CID 160721729) has the molecular formula C19H28F4O9 and a molecular weight of 476.42 g/mol. Its IUPAC name is 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-ynoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-ynoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 160721729 |
| Molecular Formula | C19H28F4O9 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 1-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-ynoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)COCCOCOCC(F)(F)OC(F)(F)COCC(O)COCC#C |
| InChI | InChI=1S/C19H28F4O9/c1-3-5-26-9-16(24)11-28-7-8-29-15-31-14-19(22,23)32-18(20,21)13-30-12-17(25)10-27-6-4-2/h1-2,16-17,24-25H,5-15H2 |
| InChIKey | RTEPFNLUASLRTN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|