C19H34F4O10 — CID 158949763
1-[2-[1,1-difluoro-2-[2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-4-prop-2-enoxybutan-2-ol (PubChem CID 158949763) has the molecular formula C19H34F4O10 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-[2-[1,1-difluoro-2-[2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-4-prop-2-enoxybutan-2-ol.
| Compound Name | 1-[2-[1,1-difluoro-2-[2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-4-prop-2-enoxybutan-2-ol |
|---|---|
| PubChem CID | 158949763 |
| Molecular Formula | C19H34F4O10 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-[2-[1,1-difluoro-2-[2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxymethoxy]ethoxy]-2,2-difluoroethoxy]-4-prop-2-enoxybutan-2-ol |
| SMILES | C=CCOCCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)COCCO |
| InChI | InChI=1S/C19H34F4O10/c1-2-5-27-6-3-16(25)10-31-13-18(20,21)33-19(22,23)14-32-15-30-9-8-29-12-17(26)11-28-7-4-24/h2,16-17,24-26H,1,3-15H2 |
| InChIKey | JLGUXFRBJKTXRP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|