C15H20N2O — CID 155002839
N-[5-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]-N-propylacetamide (PubChem CID 155002839) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[5-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]-N-propylacetamide.
| Compound Name | N-[5-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]-N-propylacetamide |
|---|---|
| PubChem CID | 155002839 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[5-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]-N-propylacetamide |
| SMILES | C=C/C(=C\C)c1ccc(N(CCC)C(C)=O)nc1 |
| InChI | InChI=1S/C15H20N2O/c1-5-10-17(12(4)18)15-9-8-14(11-16-15)13(6-2)7-3/h6-9,11H,2,5,10H2,1,3-4H3/b13-7+ |
| InChIKey | UGTNDOJQMNIXDS-NTUHNPAUSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|