C14H24N2 — CID 142541478
N,N-diethyl-5-prop-1-en-2-ylpyridin-2-amine;ethane (PubChem CID 142541478) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,N-diethyl-5-prop-1-en-2-ylpyridin-2-amine;ethane.
| Compound Name | N,N-diethyl-5-prop-1-en-2-ylpyridin-2-amine;ethane |
|---|---|
| PubChem CID | 142541478 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,N-diethyl-5-prop-1-en-2-ylpyridin-2-amine;ethane |
| SMILES | C=C(C)c1ccc(N(CC)CC)nc1.CC |
| InChI | InChI=1S/C12H18N2.C2H6/c1-5-14(6-2)12-8-7-11(9-13-12)10(3)4;1-2/h7-9H,3,5-6H2,1-2,4H3;1-2H3 |
| InChIKey | CFGNSVQAAQJCRJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |