C11H18N4O — CID 43268817
6-[ethyl(propyl)amino]-N'-hydroxypyridine-3-carboximidamide (PubChem CID 43268817) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-[ethyl(propyl)amino]-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 6-[ethyl(propyl)amino]-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 43268817 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-[ethyl(propyl)amino]-N'-hydroxypyridine-3-carboximidamide |
| SMILES | CCCN(CC)c1ccc(/C(N)=N/O)cn1 |
| InChI | InChI=1S/C11H18N4O/c1-3-7-15(4-2)10-6-5-9(8-13-10)11(12)14-16/h5-6,8,16H,3-4,7H2,1-2H3,(H2,12,14) |
| InChIKey | JGGAWTDDELYBLX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|