C11H16N4O — CID 60984897
6-[cyclopropylmethyl(methyl)amino]-N'-hydroxypyridine-3-carboximidamide (PubChem CID 60984897) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 6-[cyclopropylmethyl(methyl)amino]-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 6-[cyclopropylmethyl(methyl)amino]-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 60984897 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 6-[cyclopropylmethyl(methyl)amino]-N'-hydroxypyridine-3-carboximidamide |
| SMILES | CN(CC1CC1)c1ccc(/C(N)=N/O)cn1 |
| InChI | InChI=1S/C11H16N4O/c1-15(7-8-2-3-8)10-5-4-9(6-13-10)11(12)14-16/h4-6,8,16H,2-3,7H2,1H3,(H2,12,14) |
| InChIKey | LOXMXHWKEMCMFY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|