C34H33ClFN3O4 — CID 155004251
2-[(6S)-6-chloro-2-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohexa-2,4-dien-1-yl]-5-[ethyl(4-phenylbutyl)carbamoyl]benzoic acid (PubChem CID 155004251) has the molecular formula C34H33ClFN3O4 and a molecular weight of 602.11 g/mol. Its IUPAC name is 2-[(6S)-6-chloro-2-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohexa-2,4-dien-1-yl]-5-[ethyl(4-phenylbutyl)carbamoyl]benzoic acid.
| Compound Name | 2-[(6S)-6-chloro-2-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohexa-2,4-dien-1-yl]-5-[ethyl(4-phenylbutyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 155004251 |
| Molecular Formula | C34H33ClFN3O4 |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | 2-[(6S)-6-chloro-2-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)cyclohexa-2,4-dien-1-yl]-5-[ethyl(4-phenylbutyl)carbamoyl]benzoic acid |
| SMILES | CCN(CCCCc1ccccc1)C(=O)c1ccc(C2C(c3nc4cc(OC)c(F)cc4[nH]3)=CC=C[C@@H]2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H33ClFN3O4/c1-3-39(17-8-7-12-21-10-5-4-6-11-21)33(40)22-15-16-23(25(18-22)34(41)42)31-24(13-9-14-26(31)35)32-37-28-19-27(36)30(43-2)20-29(28)38-32/h4-6,9-11,13-16,18-20,26,31H,3,7-8,12,17H2,1-2H3,(H,37,38)(H,41,42)/t26-,31?/m0/s1 |
| InChIKey | IRWKZPIQXJQYAQ-PAMMARIWSA-N |
| XLogP | 7.24 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|