C27H39N3O5S — CID 155007262
tert-butyl 4-[(E)-4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)but-2-enyl]piperidine-1-carboxylate (PubChem CID 155007262) has the molecular formula C27H39N3O5S and a molecular weight of 517.69 g/mol. Its IUPAC name is tert-butyl 4-[(E)-4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)but-2-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)but-2-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155007262 |
| Molecular Formula | C27H39N3O5S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | tert-butyl 4-[(E)-4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)but-2-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C/C=C/CS(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1 |
| InChI | InChI=1S/C27H39N3O5S/c1-27(2,3)35-26(32)30-15-13-19(14-16-30)8-4-5-17-36(33,34)29-25(31)28-24-22-11-6-9-20(22)18-21-10-7-12-23(21)24/h4-5,18-19H,6-17H2,1-3H3,(H2,28,29,31)/b5-4+ |
| InChIKey | SRTBKPLXIJGVHW-SNAWJCMRSA-N |
| XLogP | 4.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|