C18H35NO2Si — CID 142635325
tert-butyl 4-[(E)-5-trimethylsilylpent-2-enyl]piperidine-1-carboxylate (PubChem CID 142635325) has the molecular formula C18H35NO2Si and a molecular weight of 325.57 g/mol. Its IUPAC name is tert-butyl 4-[(E)-5-trimethylsilylpent-2-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-5-trimethylsilylpent-2-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142635325 |
| Molecular Formula | C18H35NO2Si |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl 4-[(E)-5-trimethylsilylpent-2-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C/C=C/CC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H35NO2Si/c1-18(2,3)21-17(20)19-13-11-16(12-14-19)10-8-7-9-15-22(4,5)6/h7-8,16H,9-15H2,1-6H3/b8-7+ |
| InChIKey | DLCANJXQMSASMZ-BQYQJAHWSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|