C15H25NOS — CID 155010585
(1S)-2-[dimethyl(phenyl)-λ4-sulfanyl]-1-[(2S)-piperidin-2-yl]ethanol (PubChem CID 155010585) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is (1S)-2-[dimethyl(phenyl)-λ4-sulfanyl]-1-[(2S)-piperidin-2-yl]ethanol.
| Compound Name | (1S)-2-[dimethyl(phenyl)-λ4-sulfanyl]-1-[(2S)-piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 155010585 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (1S)-2-[dimethyl(phenyl)-λ4-sulfanyl]-1-[(2S)-piperidin-2-yl]ethanol |
| SMILES | CS(C)(C[C@@H](O)[C@@H]1CCCCN1)c1ccccc1 |
| InChI | InChI=1S/C15H25NOS/c1-18(2,13-8-4-3-5-9-13)12-15(17)14-10-6-7-11-16-14/h3-5,8-9,14-17H,6-7,10-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | PDNYXPGFLKUUSL-LSDHHAIUSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |