C13H19NO4S — CID 155141546
benzyl (2S)-2-hydroxy-2-[(2S)-pyrrolidin-2-yl]ethanesulfonate (PubChem CID 155141546) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is benzyl (2S)-2-hydroxy-2-[(2S)-pyrrolidin-2-yl]ethanesulfonate.
| Compound Name | benzyl (2S)-2-hydroxy-2-[(2S)-pyrrolidin-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 155141546 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | benzyl (2S)-2-hydroxy-2-[(2S)-pyrrolidin-2-yl]ethanesulfonate |
| SMILES | O=S(=O)(C[C@@H](O)[C@@H]1CCCN1)OCc1ccccc1 |
| InChI | InChI=1S/C13H19NO4S/c15-13(12-7-4-8-14-12)10-19(16,17)18-9-11-5-2-1-3-6-11/h1-3,5-6,12-15H,4,7-10H2/t12-,13+/m0/s1 |
| InChIKey | JMTVJHHDVTYKPG-QWHCGFSZSA-N |
| XLogP | 0.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|