C13H20NO2P — CID 155141516
(1S)-2-[methyl(phenyl)phosphoryl]-1-[(2S)-pyrrolidin-2-yl]ethanol (PubChem CID 155141516) has the molecular formula C13H20NO2P and a molecular weight of 253.28 g/mol. Its IUPAC name is (1S)-2-[methyl(phenyl)phosphoryl]-1-[(2S)-pyrrolidin-2-yl]ethanol.
| Compound Name | (1S)-2-[methyl(phenyl)phosphoryl]-1-[(2S)-pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 155141516 |
| Molecular Formula | C13H20NO2P |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (1S)-2-[methyl(phenyl)phosphoryl]-1-[(2S)-pyrrolidin-2-yl]ethanol |
| SMILES | CP(=O)(C[C@@H](O)[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C13H20NO2P/c1-17(16,11-6-3-2-4-7-11)10-13(15)12-8-5-9-14-12/h2-4,6-7,12-15H,5,8-10H2,1H3/t12-,13+,17?/m0/s1 |
| InChIKey | ISVONYSUHZQFLS-YORJJWTOSA-N |
| XLogP | 1.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|