C15H24O5 — CID 155012251
1-(1-ethoxypropoxy)ethyl 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 155012251) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-(1-ethoxypropoxy)ethyl 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 1-(1-ethoxypropoxy)ethyl 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 155012251 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(1-ethoxypropoxy)ethyl 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(CC)OC(C)OC(=O)C1CC2C=CC1C2O |
| InChI | InChI=1S/C15H24O5/c1-4-13(18-5-2)19-9(3)20-15(17)12-8-10-6-7-11(12)14(10)16/h6-7,9-14,16H,4-5,8H2,1-3H3 |
| InChIKey | HBPYAOXXTZIYBP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|