C15H22O6 — CID 155012010
[2-(1-ethoxypropoxy)-2-oxoethyl] 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 155012010) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [2-(1-ethoxypropoxy)-2-oxoethyl] 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(1-ethoxypropoxy)-2-oxoethyl] 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 155012010 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [2-(1-ethoxypropoxy)-2-oxoethyl] 7-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(CC)OC(=O)COC(=O)C1CC2C=CC1C2O |
| InChI | InChI=1S/C15H22O6/c1-3-13(19-4-2)21-12(16)8-20-15(18)11-7-9-5-6-10(11)14(9)17/h5-6,9-11,13-14,17H,3-4,7-8H2,1-2H3 |
| InChIKey | LNHOUYHVQPKGGN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|