C26H32N6O2 — CID 155013026
(3R)-3-[3-[4-[(E)-N-[(4-tert-butylphenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 155013026) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (3R)-3-[3-[4-[(E)-N-[(4-tert-butylphenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-3-[3-[4-[(E)-N-[(4-tert-butylphenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 155013026 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (3R)-3-[3-[4-[(E)-N-[(4-tert-butylphenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC[C@@H](c2nc(-c3ccc(/C(C)=N/OCc4ccc(C(C)(C)C)cc4)cc3)no2)C1 |
| InChI | InChI=1S/C26H32N6O2/c1-17(30-33-16-18-5-11-22(12-6-18)26(2,3)4)19-7-9-20(10-8-19)23-29-24(34-31-23)21-13-14-32(15-21)25(27)28/h5-12,21H,13-16H2,1-4H3,(H3,27,28)/b30-17+/t21-/m1/s1 |
| InChIKey | YNFQHJZZNWSXOW-BKXZIFFXSA-N |
| XLogP | 4.66 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|