C26H30F3N5O2 — CID 154660923
3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide;1-(methoxymethyl)-4-(trifluoromethyl)benzene (PubChem CID 154660923) has the molecular formula C26H30F3N5O2 and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide;1-(methoxymethyl)-4-(trifluoromethyl)benzene.
| Compound Name | 3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide;1-(methoxymethyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154660923 |
| Molecular Formula | C26H30F3N5O2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide;1-(methoxymethyl)-4-(trifluoromethyl)benzene |
| SMILES | COCc1ccc(C(F)(F)F)cc1.[H]/N=C(\N)N1CCC(c2nc(-c3ccc(/C(C)=C/C)cc3)no2)C1 |
| InChI | InChI=1S/C17H21N5O.C9H9F3O/c1-3-11(2)12-4-6-13(7-5-12)15-20-16(23-21-15)14-8-9-22(10-14)17(18)19;1-13-6-7-2-4-8(5-3-7)9(10,11)12/h3-7,14H,8-10H2,1-2H3,(H3,18,19);2-5H,6H2,1H3/b11-3+; |
| InChIKey | JJTQYKVXXFIUMO-KODGKZAJSA-N |
| XLogP | 5.69 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|