C26H34FN5O2 — CID 154660874
[3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanimine;1-fluoro-4-(methoxymethyl)benzene;methanamine (PubChem CID 154660874) has the molecular formula C26H34FN5O2 and a molecular weight of 467.59 g/mol. Its IUPAC name is [3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanimine;1-fluoro-4-(methoxymethyl)benzene;methanamine.
| Compound Name | [3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanimine;1-fluoro-4-(methoxymethyl)benzene;methanamine |
|---|---|
| PubChem CID | 154660874 |
| Molecular Formula | C26H34FN5O2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | [3-[3-[4-[(E)-but-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanimine;1-fluoro-4-(methoxymethyl)benzene;methanamine |
| SMILES | CN.COCc1ccc(F)cc1.[H]/N=C/N1CCC(c2nc(-c3ccc(/C(C)=C/C)cc3)no2)C1 |
| InChI | InChI=1S/C17H20N4O.C8H9FO.CH5N/c1-3-12(2)13-4-6-14(7-5-13)16-19-17(22-20-16)15-8-9-21(10-15)11-18;1-10-6-7-2-4-8(9)5-3-7;1-2/h3-7,11,15,18H,8-10H2,1-2H3;2-5H,6H2,1H3;2H2,1H3/b12-3+,18-11+;; |
| InChIKey | ZKIQZSKPJWRZQX-LLJBFXRBSA-N |
| XLogP | 5.10 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|