C19H25N5O2 — CID 154660997
(3R)-3-[3-[4-[(E)-5-methoxypent-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 154660997) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (3R)-3-[3-[4-[(E)-5-methoxypent-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-3-[3-[4-[(E)-5-methoxypent-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 154660997 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (3R)-3-[3-[4-[(E)-5-methoxypent-2-en-2-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC[C@@H](c2nc(-c3ccc(/C(C)=C/CCOC)cc3)no2)C1 |
| InChI | InChI=1S/C19H25N5O2/c1-13(4-3-11-25-2)14-5-7-15(8-6-14)17-22-18(26-23-17)16-9-10-24(12-16)19(20)21/h4-8,16H,3,9-12H2,1-2H3,(H3,20,21)/b13-4+/t16-/m1/s1 |
| InChIKey | BMEYDBLZDMAQOU-JILDMTJUSA-N |
| XLogP | 2.86 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|