C18H17ClFN5O2S — CID 155015363
5-[1-[(E)-1-[(2-amino-2-oxoethanethioyl)amino]prop-1-en-2-yl]pyrazol-4-yl]-4-chloro-N-cyclopropyl-2-fluorobenzamide (PubChem CID 155015363) has the molecular formula C18H17ClFN5O2S and a molecular weight of 421.89 g/mol. Its IUPAC name is 5-[1-[(E)-1-[(2-amino-2-oxoethanethioyl)amino]prop-1-en-2-yl]pyrazol-4-yl]-4-chloro-N-cyclopropyl-2-fluorobenzamide.
| Compound Name | 5-[1-[(E)-1-[(2-amino-2-oxoethanethioyl)amino]prop-1-en-2-yl]pyrazol-4-yl]-4-chloro-N-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 155015363 |
| Molecular Formula | C18H17ClFN5O2S |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 5-[1-[(E)-1-[(2-amino-2-oxoethanethioyl)amino]prop-1-en-2-yl]pyrazol-4-yl]-4-chloro-N-cyclopropyl-2-fluorobenzamide |
| SMILES | C/C(=C\NC(=S)C(N)=O)n1cc(-c2cc(C(=O)NC3CC3)c(F)cc2Cl)cn1 |
| InChI | InChI=1S/C18H17ClFN5O2S/c1-9(6-22-18(28)16(21)26)25-8-10(7-23-25)12-4-13(15(20)5-14(12)19)17(27)24-11-2-3-11/h4-8,11H,2-3H2,1H3,(H2,21,26)(H,22,28)(H,24,27)/b9-6+ |
| InChIKey | OCOBHIFKBPQXAE-RMKNXTFCSA-N |
| XLogP | 2.46 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|