C21H25FN6O3 — CID 155016295
N-[[(5S)-3-[4-[4-[[(Z)-3-amino-2-hydrazinylprop-2-enyl]amino]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 155016295) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-[[(Z)-3-amino-2-hydrazinylprop-2-enyl]amino]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[4-[[(Z)-3-amino-2-hydrazinylprop-2-enyl]amino]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 155016295 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[[(5S)-3-[4-[4-[[(Z)-3-amino-2-hydrazinylprop-2-enyl]amino]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(NC/C(=C/N)NN)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H25FN6O3/c1-13(29)25-11-18-12-28(21(30)31-18)17-6-7-19(20(22)8-17)14-2-4-15(5-3-14)26-10-16(9-23)27-24/h2-9,18,26-27H,10-12,23-24H2,1H3,(H,25,29)/b16-9-/t18-/m0/s1 |
| InChIKey | YWMOXTCYXVRTTK-VUZIPCMWSA-N |
| XLogP | 1.63 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|