C11H17FIN3 — CID 155016597
2-N-[2-(dimethylamino)ethyl]-4-fluoro-1-N-iodo-2-N-methylbenzene-1,2-diamine (PubChem CID 155016597) has the molecular formula C11H17FIN3 and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-4-fluoro-1-N-iodo-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-4-fluoro-1-N-iodo-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 155016597 |
| Molecular Formula | C11H17FIN3 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-4-fluoro-1-N-iodo-2-N-methylbenzene-1,2-diamine |
| SMILES | CN(C)CCN(C)c1cc(F)ccc1NI |
| InChI | InChI=1S/C11H17FIN3/c1-15(2)6-7-16(3)11-8-9(12)4-5-10(11)14-13/h4-5,8,14H,6-7H2,1-3H3 |
| InChIKey | YYKDFIMKFCVBEY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|