C22H22ClNO3 — CID 155017293
4-chloro-9,10-dimethoxy-2-phenylmethoxy-6,7-dihydro-4H-benzo[a]quinolizine (PubChem CID 155017293) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-chloro-9,10-dimethoxy-2-phenylmethoxy-6,7-dihydro-4H-benzo[a]quinolizine.
| Compound Name | 4-chloro-9,10-dimethoxy-2-phenylmethoxy-6,7-dihydro-4H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 155017293 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-chloro-9,10-dimethoxy-2-phenylmethoxy-6,7-dihydro-4H-benzo[a]quinolizine |
| SMILES | COc1cc2c(cc1OC)C1=CC(OCc3ccccc3)=CC(Cl)N1CC2 |
| InChI | InChI=1S/C22H22ClNO3/c1-25-20-10-16-8-9-24-19(18(16)13-21(20)26-2)11-17(12-22(24)23)27-14-15-6-4-3-5-7-15/h3-7,10-13,22H,8-9,14H2,1-2H3 |
| InChIKey | GEUYCZGNMUFRJJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|