C14H17Cl2F2N3O3S — CID 155026256
2-[(3-chloro-2-fluorophenyl)methyl]-3-(dimethylsulfamoylamino)-4-fluoropyrrolidine-1-carbonyl chloride (PubChem CID 155026256) has the molecular formula C14H17Cl2F2N3O3S and a molecular weight of 416.28 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)methyl]-3-(dimethylsulfamoylamino)-4-fluoropyrrolidine-1-carbonyl chloride.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)methyl]-3-(dimethylsulfamoylamino)-4-fluoropyrrolidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 155026256 |
| Molecular Formula | C14H17Cl2F2N3O3S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)methyl]-3-(dimethylsulfamoylamino)-4-fluoropyrrolidine-1-carbonyl chloride |
| SMILES | CN(C)S(=O)(=O)NC1C(F)CN(C(=O)Cl)C1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C14H17Cl2F2N3O3S/c1-20(2)25(23,24)19-13-10(17)7-21(14(16)22)11(13)6-8-4-3-5-9(15)12(8)18/h3-5,10-11,13,19H,6-7H2,1-2H3 |
| InChIKey | AIOODTUGOLHYRS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|