C5H11NO — CID 155026740
N,N-bis(trideuteriomethyl)propanamide (PubChem CID 155026740) has the molecular formula C5H11NO and a molecular weight of 107.19 g/mol. Its IUPAC name is N,N-bis(trideuteriomethyl)propanamide.
| Compound Name | N,N-bis(trideuteriomethyl)propanamide |
|---|---|
| PubChem CID | 155026740 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 107.19 g/mol |
| Exact Mass | 107.12 |
| IUPAC Name | N,N-bis(trideuteriomethyl)propanamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)CC)C([2H])([2H])[2H] |
| InChI | InChI=1S/C5H11NO/c1-4-5(7)6(2)3/h4H2,1-3H3/i2D3,3D3 |
| InChIKey | MBHINSULENHCMF-XERRXZQWSA-N |
| XLogP | 0.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |