C5H11Cl2NO3 — CID 87435163
N,N-dichloropropanamide;ethane-1,2-diol (PubChem CID 87435163) has the molecular formula C5H11Cl2NO3 and a molecular weight of 204.05 g/mol. Its IUPAC name is N,N-dichloropropanamide;ethane-1,2-diol.
| Compound Name | N,N-dichloropropanamide;ethane-1,2-diol |
|---|---|
| PubChem CID | 87435163 |
| Molecular Formula | C5H11Cl2NO3 |
| Molecular Weight | 204.05 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | N,N-dichloropropanamide;ethane-1,2-diol |
| SMILES | CCC(=O)N(Cl)Cl.OCCO |
| InChI | InChI=1S/C3H5Cl2NO.C2H6O2/c1-2-3(7)6(4)5;3-1-2-4/h2H2,1H3;3-4H,1-2H2 |
| InChIKey | BRMVFGDGDQOHPD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.05 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|