C11H21BNNaO7 — CID 175843123
sodium;N,N-dimethylpropanamide;triacetyloxyboranuide (PubChem CID 175843123) has the molecular formula C11H21BNNaO7 and a molecular weight of 313.09 g/mol. Its IUPAC name is sodium;N,N-dimethylpropanamide;triacetyloxyboranuide.
| Compound Name | sodium;N,N-dimethylpropanamide;triacetyloxyboranuide |
|---|---|
| PubChem CID | 175843123 |
| Molecular Formula | C11H21BNNaO7 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | sodium;N,N-dimethylpropanamide;triacetyloxyboranuide |
| SMILES | CC(=O)O[BH-](OC(C)=O)OC(C)=O.CCC(=O)N(C)C.[Na+] |
| InChI | InChI=1S/C6H10BO6.C5H11NO.Na/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-4-5(7)6(2)3;/h7H,1-3H3;4H2,1-3H3;/q-1;;+1 |
| InChIKey | RWPNAODVDFWBAM-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|