C20H40N2O5 — CID 155029953
tert-butyl 3-[2-[2-[2-[methyl-[1-[(2-methylpropan-2-yl)oxy]ethenyl]amino]ethylamino]ethoxy]ethoxy]propanoate (PubChem CID 155029953) has the molecular formula C20H40N2O5 and a molecular weight of 388.55 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[methyl-[1-[(2-methylpropan-2-yl)oxy]ethenyl]amino]ethylamino]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[methyl-[1-[(2-methylpropan-2-yl)oxy]ethenyl]amino]ethylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 155029953 |
| Molecular Formula | C20H40N2O5 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[methyl-[1-[(2-methylpropan-2-yl)oxy]ethenyl]amino]ethylamino]ethoxy]ethoxy]propanoate |
| SMILES | C=C(OC(C)(C)C)N(C)CCNCCOCCOCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O5/c1-17(26-19(2,3)4)22(8)12-10-21-11-14-25-16-15-24-13-9-18(23)27-20(5,6)7/h21H,1,9-16H2,2-8H3 |
| InChIKey | PNTXASQHWXYRRN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|