C24H31NO3S — CID 155031905
[5-[(5-ethyl-2-methyl-2,3-dihydroindol-1-yl)sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol (PubChem CID 155031905) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is [5-[(5-ethyl-2-methyl-2,3-dihydroindol-1-yl)sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol.
| Compound Name | [5-[(5-ethyl-2-methyl-2,3-dihydroindol-1-yl)sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 155031905 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [5-[(5-ethyl-2-methyl-2,3-dihydroindol-1-yl)sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol |
| SMILES | CCc1ccc2c(c1)CC(C)N2Sc1ccc(OCC2CCOCC2)c(CO)c1 |
| InChI | InChI=1S/C24H31NO3S/c1-3-18-4-6-23-20(13-18)12-17(2)25(23)29-22-5-7-24(21(14-22)15-26)28-16-19-8-10-27-11-9-19/h4-7,13-14,17,19,26H,3,8-12,15-16H2,1-2H3 |
| InChIKey | OOXKBCKAQLRTEL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|