C25H30F3NO3S — CID 155032157
[5-[[2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol (PubChem CID 155032157) has the molecular formula C25H30F3NO3S and a molecular weight of 481.58 g/mol. Its IUPAC name is [5-[[2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol.
| Compound Name | [5-[[2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 155032157 |
| Molecular Formula | C25H30F3NO3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [5-[[2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfanyl]-2-(oxan-4-ylmethoxy)phenyl]methanol |
| SMILES | CCC1CCc2cc(C(F)(F)F)ccc2N1Sc1ccc(OCC2CCOCC2)c(CO)c1 |
| InChI | InChI=1S/C25H30F3NO3S/c1-2-21-5-3-18-13-20(25(26,27)28)4-7-23(18)29(21)33-22-6-8-24(19(14-22)15-30)32-16-17-9-11-31-12-10-17/h4,6-8,13-14,17,21,30H,2-3,5,9-12,15-16H2,1H3 |
| InChIKey | VFEBKLQUEFWLSR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|