C26H32F3NO2S — CID 155032141
2,6-diethyl-1-[4-(oxan-4-ylmethoxy)-3-(trifluoromethyl)phenyl]sulfanyl-3,4-dihydro-2H-quinoline (PubChem CID 155032141) has the molecular formula C26H32F3NO2S and a molecular weight of 479.61 g/mol. Its IUPAC name is 2,6-diethyl-1-[4-(oxan-4-ylmethoxy)-3-(trifluoromethyl)phenyl]sulfanyl-3,4-dihydro-2H-quinoline.
| Compound Name | 2,6-diethyl-1-[4-(oxan-4-ylmethoxy)-3-(trifluoromethyl)phenyl]sulfanyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 155032141 |
| Molecular Formula | C26H32F3NO2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2,6-diethyl-1-[4-(oxan-4-ylmethoxy)-3-(trifluoromethyl)phenyl]sulfanyl-3,4-dihydro-2H-quinoline |
| SMILES | CCc1ccc2c(c1)CCC(CC)N2Sc1ccc(OCC2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H32F3NO2S/c1-3-18-5-9-24-20(15-18)6-7-21(4-2)30(24)33-22-8-10-25(23(16-22)26(27,28)29)32-17-19-11-13-31-14-12-19/h5,8-10,15-16,19,21H,3-4,6-7,11-14,17H2,1-2H3 |
| InChIKey | LYYFUIHVXLSMSQ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|