C15H10I4 — CID 155033336
3,4,5,6-tetraiodo-2,7-dimethyl-9H-fluorene (PubChem CID 155033336) has the molecular formula C15H10I4 and a molecular weight of 697.86 g/mol. Its IUPAC name is 3,4,5,6-tetraiodo-2,7-dimethyl-9H-fluorene.
| Compound Name | 3,4,5,6-tetraiodo-2,7-dimethyl-9H-fluorene |
|---|---|
| PubChem CID | 155033336 |
| Molecular Formula | C15H10I4 |
| Molecular Weight | 697.86 g/mol |
| Exact Mass | 697.70 |
| IUPAC Name | 3,4,5,6-tetraiodo-2,7-dimethyl-9H-fluorene |
| SMILES | Cc1cc2c(c(I)c1I)-c1c(cc(C)c(I)c1I)C2 |
| InChI | InChI=1S/C15H10I4/c1-6-3-8-5-9-4-7(2)13(17)15(19)11(9)10(8)14(18)12(6)16/h3-4H,5H2,1-2H3 |
| InChIKey | IKCBXWXUBFVIRQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.86 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|