C24H25N5O4S2 — CID 155037137
N-[2-hydroxy-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-1-propan-2-ylsulfonylpyrrole-3-carboxamide (PubChem CID 155037137) has the molecular formula C24H25N5O4S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[2-hydroxy-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-1-propan-2-ylsulfonylpyrrole-3-carboxamide.
| Compound Name | N-[2-hydroxy-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-1-propan-2-ylsulfonylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 155037137 |
| Molecular Formula | C24H25N5O4S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[2-hydroxy-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-1-propan-2-ylsulfonylpyrrole-3-carboxamide |
| SMILES | CC(C)S(=O)(=O)n1ccc(C(=O)NCC(O)Nc2nc(-c3cccc(-c4ccncc4)c3)cs2)c1 |
| InChI | InChI=1S/C24H25N5O4S2/c1-16(2)35(32,33)29-11-8-20(14-29)23(31)26-13-22(30)28-24-27-21(15-34-24)19-5-3-4-18(12-19)17-6-9-25-10-7-17/h3-12,14-16,22,30H,13H2,1-2H3,(H,26,31)(H,27,28) |
| InChIKey | KZXLEOXADPRUJE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|