C10H16N2O2S — CID 15503788
ethyl 2-(tert-butylamino)-1,3-thiazole-5-carboxylate (PubChem CID 15503788) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is ethyl 2-(tert-butylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(tert-butylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 15503788 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | ethyl 2-(tert-butylamino)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(C)(C)C)s1 |
| InChI | InChI=1S/C10H16N2O2S/c1-5-14-8(13)7-6-11-9(15-7)12-10(2,3)4/h6H,5H2,1-4H3,(H,11,12) |
| InChIKey | FOXDWVDIFKXRMN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |